C20H24N2O5S — CID 7516649
3-[[4-(diethylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 7516649) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-[[4-(diethylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[[4-(diethylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 7516649 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-[[4-(diethylcarbamoyl)phenyl]sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | CCN(CC)C(=O)c1ccc(NS(=O)(=O)c2cc(C(=O)O)cc(C)c2C)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-5-22(6-2)19(23)15-7-9-17(10-8-15)21-28(26,27)18-12-16(20(24)25)11-13(3)14(18)4/h7-12,21H,5-6H2,1-4H3,(H,24,25) |
| InChIKey | HTCKGVRXMOZWFO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |