C19H23N2O4S- — CID 9234909
3-[[4-(diethylamino)phenyl]sulfamoyl]-4,5-dimethylbenzoate (PubChem CID 9234909) has the molecular formula C19H23N2O4S- and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-[[4-(diethylamino)phenyl]sulfamoyl]-4,5-dimethylbenzoate.
| Compound Name | 3-[[4-(diethylamino)phenyl]sulfamoyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 9234909 |
| Molecular Formula | C19H23N2O4S- |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-[[4-(diethylamino)phenyl]sulfamoyl]-4,5-dimethylbenzoate |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2cc(C(=O)[O-])cc(C)c2C)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-5-21(6-2)17-9-7-16(8-10-17)20-26(24,25)18-12-15(19(22)23)11-13(3)14(18)4/h7-12,20H,5-6H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | FQZOZENITMGBNA-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|