C32H36Cl2N4O6S3 — CID 3935169
2-chloro-5-[4-chloro-3-[[4-(diethylamino)phenyl]sulfamoyl]phenyl]sulfonyl-N-[4-(diethylamino)phenyl]benzenesulfonamide (PubChem CID 3935169) has the molecular formula C32H36Cl2N4O6S3 and a molecular weight of 739.77 g/mol. Its IUPAC name is 2-chloro-5-[4-chloro-3-[[4-(diethylamino)phenyl]sulfamoyl]phenyl]sulfonyl-N-[4-(diethylamino)phenyl]benzenesulfonamide.
| Compound Name | 2-chloro-5-[4-chloro-3-[[4-(diethylamino)phenyl]sulfamoyl]phenyl]sulfonyl-N-[4-(diethylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3935169 |
| Molecular Formula | C32H36Cl2N4O6S3 |
| Molecular Weight | 739.77 g/mol |
| Exact Mass | 738.12 |
| IUPAC Name | 2-chloro-5-[4-chloro-3-[[4-(diethylamino)phenyl]sulfamoyl]phenyl]sulfonyl-N-[4-(diethylamino)phenyl]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc(NS(=O)(=O)c2cc(S(=O)(=O)c3ccc(Cl)c(S(=O)(=O)Nc4ccc(N(CC)CC)cc4)c3)ccc2Cl)cc1 |
| InChI | InChI=1S/C32H36Cl2N4O6S3/c1-5-37(6-2)25-13-9-23(10-14-25)35-46(41,42)31-21-27(17-19-29(31)33)45(39,40)28-18-20-30(34)32(22-28)47(43,44)36-24-11-15-26(16-12-24)38(7-3)8-4/h9-22,35-36H,5-8H2,1-4H3 |
| InChIKey | IZXVTVVJIKYRGA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.77 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|