C15H13Cl2N2O4S- — CID 7504123
3-[(4-amino-3,5-dichlorophenyl)sulfamoyl]-4,5-dimethylbenzoate (PubChem CID 7504123) has the molecular formula C15H13Cl2N2O4S- and a molecular weight of 388.25 g/mol. Its IUPAC name is 3-[(4-amino-3,5-dichlorophenyl)sulfamoyl]-4,5-dimethylbenzoate.
| Compound Name | 3-[(4-amino-3,5-dichlorophenyl)sulfamoyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 7504123 |
| Molecular Formula | C15H13Cl2N2O4S- |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 3-[(4-amino-3,5-dichlorophenyl)sulfamoyl]-4,5-dimethylbenzoate |
| SMILES | Cc1cc(C(=O)[O-])cc(S(=O)(=O)Nc2cc(Cl)c(N)c(Cl)c2)c1C |
| InChI | InChI=1S/C15H14Cl2N2O4S/c1-7-3-9(15(20)21)4-13(8(7)2)24(22,23)19-10-5-11(16)14(18)12(17)6-10/h3-6,19H,18H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | MRPPMFDRHMEIPQ-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|