C17H18NO6S- — CID 9236181
3-[(2,4-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoate (PubChem CID 9236181) has the molecular formula C17H18NO6S- and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[(2,4-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoate.
| Compound Name | 3-[(2,4-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 9236181 |
| Molecular Formula | C17H18NO6S- |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 3-[(2,4-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoate |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)[O-])cc(C)c2C)c(OC)c1 |
| InChI | InChI=1S/C17H19NO6S/c1-10-7-12(17(19)20)8-16(11(10)2)25(21,22)18-14-6-5-13(23-3)9-15(14)24-4/h5-9,18H,1-4H3,(H,19,20)/p-1 |
| InChIKey | MNTAHUMYDQVCTM-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |