C17H19NO6S — CID 7516507
3-[(2,5-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 7516507) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-[(2,5-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[(2,5-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 7516507 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-[(2,5-dimethoxyphenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2cc(C(=O)O)cc(C)c2C)c1 |
| InChI | InChI=1S/C17H19NO6S/c1-10-7-12(17(19)20)8-16(11(10)2)25(21,22)18-14-9-13(23-3)5-6-15(14)24-4/h5-9,18H,1-4H3,(H,19,20) |
| InChIKey | UPERAQUJKPSGOG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |