3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid

C18H21NO5S — CID 9238408

IUPAC3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid
SMILESCCCOc1ccccc1NS(=O)(=O)c1cc(C(=O)O)cc(C)c1C
InChIInChI=1S/C18H21NO5S/c1-4-9-24-16-8-6-5-7-15(16)19-25(22,23)17-11-14(18(20)21)10-12(2)13(17)3/h5-8,10-11,19H,4,9H2,1-3H3,(H,20,21)
InChIKeyXRNFWEBNTHCDKP-UHFFFAOYSA-N
MW363.44 g/mol
LogP3.59
Rot. Bonds7

About 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid

3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid (PubChem CID 9238408) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid.

Molecular Properties

Compound Name3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid
PubChem CID9238408
Molecular FormulaC18H21NO5S
Molecular Weight363.44 g/mol
Exact Mass363.11
IUPAC Name3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid
SMILESCCCOc1ccccc1NS(=O)(=O)c1cc(C(=O)O)cc(C)c1C
InChIInChI=1S/C18H21NO5S/c1-4-9-24-16-8-6-5-7-15(16)19-25(22,23)17-11-14(18(20)21)10-12(2)13(17)3/h5-8,10-11,19H,4,9H2,1-3H3,(H,20,21)
InChIKeyXRNFWEBNTHCDKP-UHFFFAOYSA-N
XLogP3.59
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.44
LogP ≤ 53.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid?
The IUPAC name of 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid (CID 9238408) is 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid.
What is the SMILES notation for 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid?
The canonical SMILES for 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid is CCCOc1ccccc1NS(=O)(=O)c1cc(C(=O)O)cc(C)c1C.
What is the InChIKey of 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid?
The InChIKey is XRNFWEBNTHCDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO5S/c1-4-9-24-16-8-6-5-7-15(16)19-25(22,23)17-11-14(18(20)21)10-12(2)13(17)3/h5-8,10-11,19H,4,9H2,1-3H3,(H,20,21).
What are the key properties of 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid?
3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid has a molecular weight of 363.44 g/mol, XLogP of 3.59, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-[(2-propoxyphenyl)sulfamoyl]benzoic acid is sourced from PubChem (CID 9238408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).