C15H14FNO4S — CID 805440
3-[(2-fluorophenyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 805440) has the molecular formula C15H14FNO4S and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[(2-fluorophenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 805440 |
| Molecular Formula | C15H14FNO4S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2ccccc2F)c1C |
| InChI | InChI=1S/C15H14FNO4S/c1-9-7-11(15(18)19)8-14(10(9)2)22(20,21)17-13-6-4-3-5-12(13)16/h3-8,17H,1-2H3,(H,18,19) |
| InChIKey | QBQNPTOJOWLCPW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |