C22H21N3O5S — CID 24622089
3,4-dimethyl-5-[[3-(phenylcarbamoylamino)phenyl]sulfamoyl]benzoic acid (PubChem CID 24622089) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is 3,4-dimethyl-5-[[3-(phenylcarbamoylamino)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 3,4-dimethyl-5-[[3-(phenylcarbamoylamino)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 24622089 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 3,4-dimethyl-5-[[3-(phenylcarbamoylamino)phenyl]sulfamoyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)Nc2cccc(NC(=O)Nc3ccccc3)c2)c1C |
| InChI | InChI=1S/C22H21N3O5S/c1-14-11-16(21(26)27)12-20(15(14)2)31(29,30)25-19-10-6-9-18(13-19)24-22(28)23-17-7-4-3-5-8-17/h3-13,25H,1-2H3,(H,26,27)(H2,23,24,28) |
| InChIKey | VWLNYXRKEWYXPU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |