C22H22N4O4S — CID 166201010
3,4-dimethyl-N-[4-(phenylcarbamoylamino)phenyl]-5-sulfamoylbenzamide (PubChem CID 166201010) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-(phenylcarbamoylamino)phenyl]-5-sulfamoylbenzamide.
| Compound Name | 3,4-dimethyl-N-[4-(phenylcarbamoylamino)phenyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 166201010 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3,4-dimethyl-N-[4-(phenylcarbamoylamino)phenyl]-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C22H22N4O4S/c1-14-12-16(13-20(15(14)2)31(23,29)30)21(27)24-18-8-10-19(11-9-18)26-22(28)25-17-6-4-3-5-7-17/h3-13H,1-2H3,(H,24,27)(H2,23,29,30)(H2,25,26,28) |
| InChIKey | HOIMKEHJDZHQEQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |