C16H20N4O5S2 — CID 55551931
3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(sulfamoylamino)phenyl]benzamide (PubChem CID 55551931) has the molecular formula C16H20N4O5S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(sulfamoylamino)phenyl]benzamide.
| Compound Name | 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(sulfamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 55551931 |
| Molecular Formula | C16H20N4O5S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(sulfamoylamino)phenyl]benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2cccc(NS(N)(=O)=O)c2)cc(C)c1C |
| InChI | InChI=1S/C16H20N4O5S2/c1-10-7-12(8-15(11(10)2)26(22,23)18-3)16(21)19-13-5-4-6-14(9-13)20-27(17,24)25/h4-9,18,20H,1-3H3,(H,19,21)(H2,17,24,25) |
| InChIKey | ATFMETNNKOKUSF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |