C23H26N4O3S — CID 55884527
3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide (PubChem CID 55884527) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55884527 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3,4-dimethyl-5-(methylsulfamoyl)-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2cccc(-c3cn4c(n3)CCCC4)c2)cc(C)c1C |
| InChI | InChI=1S/C23H26N4O3S/c1-15-11-18(13-21(16(15)2)31(29,30)24-3)23(28)25-19-8-6-7-17(12-19)20-14-27-10-5-4-9-22(27)26-20/h6-8,11-14,24H,4-5,9-10H2,1-3H3,(H,25,28) |
| InChIKey | MLKMRCZFHYQEMJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |