C21H28N4O2 — CID 71887416
3,3-dimethyl-N-[2-oxo-2-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)anilino]ethyl]butanamide (PubChem CID 71887416) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-oxo-2-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)anilino]ethyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[2-oxo-2-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)anilino]ethyl]butanamide |
|---|---|
| PubChem CID | 71887416 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 3,3-dimethyl-N-[2-oxo-2-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)anilino]ethyl]butanamide |
| SMILES | CC(C)(C)CC(=O)NCC(=O)Nc1cccc(-c2cn3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C21H28N4O2/c1-21(2,3)12-19(26)22-13-20(27)23-16-8-6-7-15(11-16)17-14-25-10-5-4-9-18(25)24-17/h6-8,11,14H,4-5,9-10,12-13H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | IBZJRPAVSAJHGV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |