C25H26N4O2S — CID 56567177
4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]butanamide (PubChem CID 56567177) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]butanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 56567177 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-oxo-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]butanamide |
| SMILES | O=C(CCC(=O)N1CCSc2ccccc21)Nc1cccc(-c2cn3c(n2)CCCC3)c1 |
| InChI | InChI=1S/C25H26N4O2S/c30-24(11-12-25(31)29-14-15-32-22-9-2-1-8-21(22)29)26-19-7-5-6-18(16-19)20-17-28-13-4-3-10-23(28)27-20/h1-2,5-9,16-17H,3-4,10-15H2,(H,26,30) |
| InChIKey | HNSYBYADBWIDTN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |