C20H16Cl2FN3O — CID 60525309
2,4-dichloro-5-fluoro-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide (PubChem CID 60525309) has the molecular formula C20H16Cl2FN3O and a molecular weight of 404.27 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 60525309 |
| Molecular Formula | C20H16Cl2FN3O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2cn3c(n2)CCCC3)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2FN3O/c21-15-10-16(22)17(23)9-14(15)20(27)24-13-5-3-4-12(8-13)18-11-26-7-2-1-6-19(26)25-18/h3-5,8-11H,1-2,6-7H2,(H,24,27) |
| InChIKey | FOTPXPAXULXZBB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|