C12H11N3O5S — CID 61130491
6-oxo-N-[3-(sulfamoylamino)phenyl]pyran-3-carboxamide (PubChem CID 61130491) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is 6-oxo-N-[3-(sulfamoylamino)phenyl]pyran-3-carboxamide.
| Compound Name | 6-oxo-N-[3-(sulfamoylamino)phenyl]pyran-3-carboxamide |
|---|---|
| PubChem CID | 61130491 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-oxo-N-[3-(sulfamoylamino)phenyl]pyran-3-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)c2ccc(=O)oc2)c1 |
| InChI | InChI=1S/C12H11N3O5S/c13-21(18,19)15-10-3-1-2-9(6-10)14-12(17)8-4-5-11(16)20-7-8/h1-7,15H,(H,14,17)(H2,13,18,19) |
| InChIKey | KGHYPHGDTGMTSM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |