C12H11BrN4O3S — CID 103754216
2-bromo-N-[3-(sulfamoylamino)phenyl]pyridine-4-carboxamide (PubChem CID 103754216) has the molecular formula C12H11BrN4O3S and a molecular weight of 371.22 g/mol. Its IUPAC name is 2-bromo-N-[3-(sulfamoylamino)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[3-(sulfamoylamino)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103754216 |
| Molecular Formula | C12H11BrN4O3S |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2-bromo-N-[3-(sulfamoylamino)phenyl]pyridine-4-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)c2ccnc(Br)c2)c1 |
| InChI | InChI=1S/C12H11BrN4O3S/c13-11-6-8(4-5-15-11)12(18)16-9-2-1-3-10(7-9)17-21(14,19)20/h1-7,17H,(H,16,18)(H2,14,19,20) |
| InChIKey | LACXPPHQIBDNTB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|