C11H10BrN3O4S — CID 106853237
2-bromo-N-[3-(sulfamoylamino)phenyl]furan-3-carboxamide (PubChem CID 106853237) has the molecular formula C11H10BrN3O4S and a molecular weight of 360.19 g/mol. Its IUPAC name is 2-bromo-N-[3-(sulfamoylamino)phenyl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[3-(sulfamoylamino)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106853237 |
| Molecular Formula | C11H10BrN3O4S |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-bromo-N-[3-(sulfamoylamino)phenyl]furan-3-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)c2ccoc2Br)c1 |
| InChI | InChI=1S/C11H10BrN3O4S/c12-10-9(4-5-19-10)11(16)14-7-2-1-3-8(6-7)15-20(13,17)18/h1-6,15H,(H,14,16)(H2,13,17,18) |
| InChIKey | KMLQAMZHOCAZPJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |