C11H10ClN3O4S — CID 60727989
5-chloro-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide (PubChem CID 60727989) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is 5-chloro-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide.
| Compound Name | 5-chloro-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60727989 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 5-chloro-N-[3-(sulfamoylamino)phenyl]furan-2-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)c2ccc(Cl)o2)c1 |
| InChI | InChI=1S/C11H10ClN3O4S/c12-10-5-4-9(19-10)11(16)14-7-2-1-3-8(6-7)15-20(13,17)18/h1-6,15H,(H,14,16)(H2,13,17,18) |
| InChIKey | NPZPJZRBGWLBAP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |