C9H10N6O3S — CID 113226196
N-[3-(sulfamoylamino)phenyl]-2H-triazole-4-carboxamide (PubChem CID 113226196) has the molecular formula C9H10N6O3S and a molecular weight of 282.29 g/mol. Its IUPAC name is N-[3-(sulfamoylamino)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[3-(sulfamoylamino)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 113226196 |
| Molecular Formula | C9H10N6O3S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-[3-(sulfamoylamino)phenyl]-2H-triazole-4-carboxamide |
| SMILES | NS(=O)(=O)Nc1cccc(NC(=O)c2cn[nH]n2)c1 |
| InChI | InChI=1S/C9H10N6O3S/c10-19(17,18)14-7-3-1-2-6(4-7)12-9(16)8-5-11-15-13-8/h1-5,14H,(H,12,16)(H2,10,17,18)(H,11,13,15) |
| InChIKey | XKKORUPYQZFKMN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |