C9H7IN4O — CID 47338141
N-(3-iodophenyl)-2H-triazole-4-carboxamide (PubChem CID 47338141) has the molecular formula C9H7IN4O and a molecular weight of 314.09 g/mol. Its IUPAC name is N-(3-iodophenyl)-2H-triazole-4-carboxamide.
| Compound Name | N-(3-iodophenyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 47338141 |
| Molecular Formula | C9H7IN4O |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | N-(3-iodophenyl)-2H-triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)c1cn[nH]n1 |
| InChI | InChI=1S/C9H7IN4O/c10-6-2-1-3-7(4-6)12-9(15)8-5-11-14-13-8/h1-5H,(H,12,15)(H,11,13,14) |
| InChIKey | LNFMXECATLOCKW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|