C15H19BN4O3 — CID 164648639
N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-triazole-4-carboxamide (PubChem CID 164648639) has the molecular formula C15H19BN4O3 and a molecular weight of 314.15 g/mol. Its IUPAC name is N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 164648639 |
| Molecular Formula | C15H19BN4O3 |
| Molecular Weight | 314.15 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2H-triazole-4-carboxamide |
| SMILES | CC1(C)OB(c2cccc(NC(=O)c3cn[nH]n3)c2)OC1(C)C |
| InChI | InChI=1S/C15H19BN4O3/c1-14(2)15(3,4)23-16(22-14)10-6-5-7-11(8-10)18-13(21)12-9-17-20-19-12/h5-9H,1-4H3,(H,18,21)(H,17,19,20) |
| InChIKey | NPNGQWXETOLENE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|