C15H21BF2N2O3 — CID 59321175
3-amino-2,2-difluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (PubChem CID 59321175) has the molecular formula C15H21BF2N2O3 and a molecular weight of 326.15 g/mol. Its IUPAC name is 3-amino-2,2-difluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide.
| Compound Name | 3-amino-2,2-difluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 59321175 |
| Molecular Formula | C15H21BF2N2O3 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-amino-2,2-difluoro-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| SMILES | CC1(C)OB(c2cccc(NC(=O)C(F)(F)CN)c2)OC1(C)C |
| InChI | InChI=1S/C15H21BF2N2O3/c1-13(2)14(3,4)23-16(22-13)10-6-5-7-11(8-10)20-12(21)15(17,18)9-19/h5-8H,9,19H2,1-4H3,(H,20,21) |
| InChIKey | UUMCSYFCPVIAQE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|