C19H31BN2O4 — CID 90391075
tert-butyl N-ethyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]carbamate (PubChem CID 90391075) has the molecular formula C19H31BN2O4 and a molecular weight of 362.28 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]carbamate |
|---|---|
| PubChem CID | 90391075 |
| Molecular Formula | C19H31BN2O4 |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | tert-butyl N-ethyl-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)anilino]carbamate |
| SMILES | CCN(Nc1cccc(B2OC(C)(C)C(C)(C)O2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31BN2O4/c1-9-22(16(23)24-17(2,3)4)21-15-12-10-11-14(13-15)20-25-18(5,6)19(7,8)26-20/h10-13,21H,9H2,1-8H3 |
| InChIKey | LYVMXJXPNLFXLX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|