C20H29BO5 — CID 154723296
tert-butyl [(E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] carbonate (PubChem CID 154723296) has the molecular formula C20H29BO5 and a molecular weight of 360.26 g/mol. Its IUPAC name is tert-butyl [(E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] carbonate.
| Compound Name | tert-butyl [(E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] carbonate |
|---|---|
| PubChem CID | 154723296 |
| Molecular Formula | C20H29BO5 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | tert-butyl [(E)-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-enyl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC/C=C/c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H29BO5/c1-18(2,3)24-17(22)23-13-9-11-15-10-8-12-16(14-15)21-25-19(4,5)20(6,7)26-21/h8-12,14H,13H2,1-7H3/b11-9+ |
| InChIKey | LQQVPPSXLYHVHI-PKNBQFBNSA-N |
| XLogP | 3.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|