C14H25BO5 — CID 25023111
tert-butyl [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] carbonate (PubChem CID 25023111) has the molecular formula C14H25BO5 and a molecular weight of 284.16 g/mol. Its IUPAC name is tert-butyl [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] carbonate.
| Compound Name | tert-butyl [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] carbonate |
|---|---|
| PubChem CID | 25023111 |
| Molecular Formula | C14H25BO5 |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | tert-butyl [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H25BO5/c1-12(2,3)18-11(16)17-10-8-9-15-19-13(4,5)14(6,7)20-15/h8-9H,10H2,1-7H3/b9-8+ |
| InChIKey | FOQFJZPIPXTZLB-CMDGGOBGSA-N |
| XLogP | 3.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|