C18H32BNO6 — CID 174053032
3-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]butanoic acid (PubChem CID 174053032) has the molecular formula C18H32BNO6 and a molecular weight of 369.27 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]butanoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]butanoic acid |
|---|---|
| PubChem CID | 174053032 |
| Molecular Formula | C18H32BNO6 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonyl-[(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)N(C/C=C/B1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32BNO6/c1-13(12-14(21)22)20(15(23)24-16(2,3)4)11-9-10-19-25-17(5,6)18(7,8)26-19/h9-10,13H,11-12H2,1-8H3,(H,21,22)/b10-9+ |
| InChIKey | RTHSWAWWZMDPKY-MDZDMXLPSA-N |
| XLogP | 3.27 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|