C22H40BNO6 — CID 155738497
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl]carbamate (PubChem CID 155738497) has the molecular formula C22H40BNO6 and a molecular weight of 425.38 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl]carbamate |
|---|---|
| PubChem CID | 155738497 |
| Molecular Formula | C22H40BNO6 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-5-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCC/C=C/B1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40BNO6/c1-19(2,3)27-17(25)24(18(26)28-20(4,5)6)16-14-12-11-13-15-23-29-21(7,8)22(9,10)30-23/h13,15H,11-12,14,16H2,1-10H3/b15-13+ |
| InChIKey | FSEAKMHRJPFUDA-FYWRMAATSA-N |
| XLogP | 5.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|