C18H32BNO5 — CID 174072908
tert-butyl N-(2-oxoethyl)-N-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]carbamate (PubChem CID 174072908) has the molecular formula C18H32BNO5 and a molecular weight of 353.27 g/mol. Its IUPAC name is tert-butyl N-(2-oxoethyl)-N-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]carbamate.
| Compound Name | tert-butyl N-(2-oxoethyl)-N-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]carbamate |
|---|---|
| PubChem CID | 174072908 |
| Molecular Formula | C18H32BNO5 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | tert-butyl N-(2-oxoethyl)-N-[(E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC=O)CCC/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H32BNO5/c1-16(2,3)23-15(22)20(13-14-21)12-10-8-9-11-19-24-17(4,5)18(6,7)25-19/h9,11,14H,8,10,12-13H2,1-7H3/b11-9+ |
| InChIKey | DRYGYBQQLFROKX-PKNBQFBNSA-N |
| XLogP | 3.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|