About tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane
tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane (PubChem CID 143848647) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane.
Molecular Properties
| Compound Name | tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane |
| PubChem CID | 143848647 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane |
| SMILES | C.CC1(CN(CC=O)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H21NO3.CH4/c1-11(2,3)16-10(15)13(7-8-14)9-12(4)5-6-12;/h8H,5-7,9H2,1-4H3;1H4 |
| InChIKey | MSXVXMMHSVUGRG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane?
The IUPAC name of tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane (CID 143848647) is tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane.
What is the SMILES notation for tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane?
The canonical SMILES for tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane is C.CC1(CN(CC=O)C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane?
The InChIKey is MSXVXMMHSVUGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3.CH4/c1-11(2,3)16-10(15)13(7-8-14)9-12(4)5-6-12;/h8H,5-7,9H2,1-4H3;1H4.
What are the key properties of tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane?
tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane has a molecular weight of 243.35 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1-methylcyclopropyl)methyl]-N-(2-oxoethyl)carbamate;methane is sourced from PubChem (CID 143848647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).