C18H26N2O2 — CID 158412865
tert-butyl N,N-bis(prop-2-ynyl)carbamate;methane;N-prop-2-ynylprop-2-yn-1-amine (PubChem CID 158412865) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is tert-butyl N,N-bis(prop-2-ynyl)carbamate;methane;N-prop-2-ynylprop-2-yn-1-amine.
| Compound Name | tert-butyl N,N-bis(prop-2-ynyl)carbamate;methane;N-prop-2-ynylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 158412865 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl N,N-bis(prop-2-ynyl)carbamate;methane;N-prop-2-ynylprop-2-yn-1-amine |
| SMILES | C.C#CCN(CC#C)C(=O)OC(C)(C)C.C#CCNCC#C |
| InChI | InChI=1S/C11H15NO2.C6H7N.CH4/c1-6-8-12(9-7-2)10(13)14-11(3,4)5;1-3-5-7-6-4-2;/h1-2H,8-9H2,3-5H3;1-2,7H,5-6H2;1H4 |
| InChIKey | GZNIPOXKFLPKCU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|