C14H18N2O6 — CID 123734179
(2,5-dihydroxypyrrol-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-ynylamino]acetate (PubChem CID 123734179) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-ynylamino]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-ynylamino]acetate |
|---|---|
| PubChem CID | 123734179 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonyl-prop-2-ynylamino]acetate |
| SMILES | C#CCN(CC(=O)On1c(O)ccc1O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18N2O6/c1-5-8-15(13(20)21-14(2,3)4)9-12(19)22-16-10(17)6-7-11(16)18/h1,6-7,17-18H,8-9H2,2-4H3 |
| InChIKey | PDVDZSZIAWKRNH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|