C12H18BrNO2 — CID 102176875
tert-butyl N-[(E)-4-bromobut-2-enyl]-N-prop-2-ynylcarbamate (PubChem CID 102176875) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-bromobut-2-enyl]-N-prop-2-ynylcarbamate.
| Compound Name | tert-butyl N-[(E)-4-bromobut-2-enyl]-N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 102176875 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | tert-butyl N-[(E)-4-bromobut-2-enyl]-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(C/C=C/CBr)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18BrNO2/c1-5-9-14(10-7-6-8-13)11(15)16-12(2,3)4/h1,6-7H,8-10H2,2-4H3/b7-6+ |
| InChIKey | LKRGHBOURGLCRI-VOTSOKGWSA-N |
| XLogP | 2.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|