C9H13NO5 — CID 54472893
tert-butyl (2,5-dihydroxypyrrol-1-yl) carbonate (PubChem CID 54472893) has the molecular formula C9H13NO5 and a molecular weight of 215.20 g/mol. Its IUPAC name is tert-butyl (2,5-dihydroxypyrrol-1-yl) carbonate.
| Compound Name | tert-butyl (2,5-dihydroxypyrrol-1-yl) carbonate |
|---|---|
| PubChem CID | 54472893 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | tert-butyl (2,5-dihydroxypyrrol-1-yl) carbonate |
| SMILES | CC(C)(C)OC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C9H13NO5/c1-9(2,3)14-8(13)15-10-6(11)4-5-7(10)12/h4-5,11-12H,1-3H3 |
| InChIKey | XJNSFIJFUHPWQA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |