C18H29NO6 — CID 91216455
1-O-tert-butyl 10-O-(2,5-dihydroxypyrrol-1-yl) decanedioate (PubChem CID 91216455) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-O-tert-butyl 10-O-(2,5-dihydroxypyrrol-1-yl) decanedioate.
| Compound Name | 1-O-tert-butyl 10-O-(2,5-dihydroxypyrrol-1-yl) decanedioate |
|---|---|
| PubChem CID | 91216455 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-O-tert-butyl 10-O-(2,5-dihydroxypyrrol-1-yl) decanedioate |
| SMILES | CC(C)(C)OC(=O)CCCCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C18H29NO6/c1-18(2,3)24-16(22)10-8-6-4-5-7-9-11-17(23)25-19-14(20)12-13-15(19)21/h12-13,20-21H,4-11H2,1-3H3 |
| InChIKey | ZPPBWWOXUHJGOA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|