C14H24N2O2 — CID 107242920
tert-butyl N-cyclopropyl-N-[3-(prop-2-ynylamino)propyl]carbamate (PubChem CID 107242920) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[3-(prop-2-ynylamino)propyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[3-(prop-2-ynylamino)propyl]carbamate |
|---|---|
| PubChem CID | 107242920 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[3-(prop-2-ynylamino)propyl]carbamate |
| SMILES | C#CCNCCCN(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-5-9-15-10-6-11-16(12-7-8-12)13(17)18-14(2,3)4/h1,12,15H,6-11H2,2-4H3 |
| InChIKey | OGKRGVLJEMEIMF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|