C12H23NO2 — CID 63788161
tert-butyl N-butyl-N-cyclopropylcarbamate (PubChem CID 63788161) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is tert-butyl N-butyl-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-butyl-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 63788161 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | tert-butyl N-butyl-N-cyclopropylcarbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C12H23NO2/c1-5-6-9-13(10-7-8-10)11(14)15-12(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | IEBQQYUXRYGOHJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |