About tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate
tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 63789055) has the molecular formula C10H16F3NO2
and a molecular weight of 239.24 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate.
Analyze tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate?
The IUPAC name of tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate (CID 63789055) is tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate.
What is the SMILES notation for tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate?
The canonical SMILES for tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate is CC(C)(C)OC(=O)N(CC(F)(F)F)C1CC1.
What is the InChIKey of tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate?
The InChIKey is ASRJOPKJENMAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO2/c1-9(2,3)16-8(15)14(7-4-5-7)6-10(11,12)13/h7H,4-6H2,1-3H3.
What are the key properties of tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate?
tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate has a molecular weight of 239.24 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-cyclopropyl-N-(2,2,2-trifluoroethyl)carbamate is sourced from PubChem (CID 63789055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).