C16H31NO3 — CID 174542178
tert-butyl N-cyclohexyl-N-(2-hydroxy-2-methylbutyl)carbamate (PubChem CID 174542178) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-cyclohexyl-N-(2-hydroxy-2-methylbutyl)carbamate.
| Compound Name | tert-butyl N-cyclohexyl-N-(2-hydroxy-2-methylbutyl)carbamate |
|---|---|
| PubChem CID | 174542178 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | tert-butyl N-cyclohexyl-N-(2-hydroxy-2-methylbutyl)carbamate |
| SMILES | CCC(C)(O)CN(C(=O)OC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C16H31NO3/c1-6-16(5,19)12-17(13-10-8-7-9-11-13)14(18)20-15(2,3)4/h13,19H,6-12H2,1-5H3 |
| InChIKey | CDEURKFJEBAYMD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |