C24H47NO10S — CID 177239965
2-[2-[2-[2-[2-[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 177239965) has the molecular formula C24H47NO10S and a molecular weight of 541.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[2-[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 177239965 |
| Molecular Formula | C24H47NO10S |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOCCOCCOCCOCCOS(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C24H47NO10S/c1-24(2,3)35-23(26)25(22-8-6-5-7-9-22)10-11-29-12-13-30-14-15-31-16-17-32-18-19-33-20-21-34-36(4,27)28/h22H,5-21H2,1-4H3 |
| InChIKey | XPWVZAJDZMMQIM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|