C13H25NO5S — CID 58676250
tert-butyl N-cyclohexyl-N-[2-(trioxidanylsulfanyl)ethyl]carbamate (PubChem CID 58676250) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is tert-butyl N-cyclohexyl-N-[2-(trioxidanylsulfanyl)ethyl]carbamate.
| Compound Name | tert-butyl N-cyclohexyl-N-[2-(trioxidanylsulfanyl)ethyl]carbamate |
|---|---|
| PubChem CID | 58676250 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | tert-butyl N-cyclohexyl-N-[2-(trioxidanylsulfanyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCSOOO)C1CCCCC1 |
| InChI | InChI=1S/C13H25NO5S/c1-13(2,3)17-12(15)14(9-10-20-19-18-16)11-7-5-4-6-8-11/h11,16H,4-10H2,1-3H3 |
| InChIKey | YWYRQYSVWYNULK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|