C24H46N2O4 — CID 135248450
tert-butyl N-cyclohexyl-N-[3-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]propyl]carbamate (PubChem CID 135248450) has the molecular formula C24H46N2O4 and a molecular weight of 426.64 g/mol. Its IUPAC name is tert-butyl N-cyclohexyl-N-[3-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]propyl]carbamate.
| Compound Name | tert-butyl N-cyclohexyl-N-[3-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]propyl]carbamate |
|---|---|
| PubChem CID | 135248450 |
| Molecular Formula | C24H46N2O4 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | tert-butyl N-cyclohexyl-N-[3-[(2-methylpropan-2-yl)oxycarbonyl-pentylamino]propyl]carbamate |
| SMILES | CCCCCN(CCCN(C(=O)OC(C)(C)C)C1CCCCC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H46N2O4/c1-8-9-13-17-25(21(27)29-23(2,3)4)18-14-19-26(20-15-11-10-12-16-20)22(28)30-24(5,6)7/h20H,8-19H2,1-7H3 |
| InChIKey | AKVAARISACGYFP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|