C15H27NO4 — CID 22397343
ethyl 3-[cyclopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 22397343) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 3-[cyclopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | ethyl 3-[cyclopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 22397343 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethyl 3-[cyclopentyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)OC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C15H27NO4/c1-5-19-13(17)10-11-16(12-8-6-7-9-12)14(18)20-15(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | QUUJGJFPXZYLFK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |