C10H14F3NO4 — CID 174663635
[cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2,2-trifluoroacetate (PubChem CID 174663635) has the molecular formula C10H14F3NO4 and a molecular weight of 269.22 g/mol. Its IUPAC name is [cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174663635 |
| Molecular Formula | C10H14F3NO4 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [cyclopropyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)OC(=O)N(OC(=O)C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H14F3NO4/c1-9(2,3)17-8(16)14(6-4-5-6)18-7(15)10(11,12)13/h6H,4-5H2,1-3H3 |
| InChIKey | SLIPXQCWXXXITB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|