C11H22N2O2 — CID 146670008
tert-butyl N-[(3S)-3-aminocyclopentyl]-N-methylcarbamate (PubChem CID 146670008) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is tert-butyl N-[(3S)-3-aminocyclopentyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3S)-3-aminocyclopentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 146670008 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | tert-butyl N-[(3S)-3-aminocyclopentyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CC[C@H](N)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)15-10(14)13(4)9-6-5-8(12)7-9/h8-9H,5-7,12H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | KAUUUTDOHYYFTF-IENPIDJESA-N |
| XLogP | 1.73 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |