C16H32FN3O2 — CID 168947799
tert-butyl N-[4-[[(3S)-3-aminocyclopentyl]-methylamino]-3-fluorobutyl]-N-methylcarbamate (PubChem CID 168947799) has the molecular formula C16H32FN3O2 and a molecular weight of 317.45 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3S)-3-aminocyclopentyl]-methylamino]-3-fluorobutyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[[(3S)-3-aminocyclopentyl]-methylamino]-3-fluorobutyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168947799 |
| Molecular Formula | C16H32FN3O2 |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | tert-butyl N-[4-[[(3S)-3-aminocyclopentyl]-methylamino]-3-fluorobutyl]-N-methylcarbamate |
| SMILES | CN(CCC(F)CN(C)C1CC[C@H](N)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H32FN3O2/c1-16(2,3)22-15(21)19(4)9-8-12(17)11-20(5)14-7-6-13(18)10-14/h12-14H,6-11,18H2,1-5H3/t12?,13-,14?/m0/s1 |
| InChIKey | ZAPZNBRJHLTTHD-MOKVOYLWSA-N |
| XLogP | 2.39 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |