About tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate
tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate (PubChem CID 155943485) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate.
Analyze tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate?
The IUPAC name of tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate (CID 155943485) is tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate?
The canonical SMILES for tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate is CN(CCC(N)C(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate?
The InChIKey is QIFZPBNRTKSNLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-12(2,3)10(14)8-9-15(7)11(16)17-13(4,5)6/h10H,8-9,14H2,1-7H3.
What are the key properties of tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate?
tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate has a molecular weight of 244.38 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-amino-4,4-dimethylpentyl)-N-methylcarbamate is sourced from PubChem (CID 155943485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).