C11H24N2O3 — CID 166938037
tert-butyl N-[2-[(2S)-2-aminopropoxy]ethyl]-N-methylcarbamate (PubChem CID 166938037) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-2-aminopropoxy]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(2S)-2-aminopropoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166938037 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | tert-butyl N-[2-[(2S)-2-aminopropoxy]ethyl]-N-methylcarbamate |
| SMILES | C[C@H](N)COCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-9(12)8-15-7-6-13(5)10(14)16-11(2,3)4/h9H,6-8,12H2,1-5H3/t9-/m0/s1 |
| InChIKey | OFTKFMGXPTWIPO-VIFPVBQESA-N |
| XLogP | 1.22 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|