C12H23NO3 — CID 166698146
tert-butyl N-(2-but-1-en-2-yloxyethyl)-N-methylcarbamate (PubChem CID 166698146) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-(2-but-1-en-2-yloxyethyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(2-but-1-en-2-yloxyethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 166698146 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl N-(2-but-1-en-2-yloxyethyl)-N-methylcarbamate |
| SMILES | C=C(CC)OCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO3/c1-7-10(2)15-9-8-13(6)11(14)16-12(3,4)5/h2,7-9H2,1,3-6H3 |
| InChIKey | PAJWUVJFNJORHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|