About tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide
tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide (PubChem CID 158416734) has the molecular formula C9H19NO5S
and a molecular weight of 253.32 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide.
Molecular Properties
| Compound Name | tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide |
| PubChem CID | 158416734 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide |
| SMILES | COCCN(C)C(=O)OC(C)(C)C.O=S=O |
| InChI | InChI=1S/C9H19NO3.O2S/c1-9(2,3)13-8(11)10(4)6-7-12-5;1-3-2/h6-7H2,1-5H3; |
| InChIKey | GZZJNGDFHRBPDN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide?
The IUPAC name of tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide (CID 158416734) is tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide.
What is the SMILES notation for tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide?
The canonical SMILES for tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide is COCCN(C)C(=O)OC(C)(C)C.O=S=O.
What is the InChIKey of tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide?
The InChIKey is GZZJNGDFHRBPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3.O2S/c1-9(2,3)13-8(11)10(4)6-7-12-5;1-3-2/h6-7H2,1-5H3;.
What are the key properties of tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide?
tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide has a molecular weight of 253.32 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-methoxyethyl)-N-methylcarbamate;sulfur dioxide is sourced from PubChem (CID 158416734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).